C22H46N2 — CID 166564865
7-(3-tert-butylpiperidin-1-yl)-N-(3,3-dimethylbutyl)heptan-1-amine (PubChem CID 166564865) has the molecular formula C22H46N2 and a molecular weight of 338.62 g/mol. Its IUPAC name is 7-(3-tert-butylpiperidin-1-yl)-N-(3,3-dimethylbutyl)heptan-1-amine.
| Compound Name | 7-(3-tert-butylpiperidin-1-yl)-N-(3,3-dimethylbutyl)heptan-1-amine |
|---|---|
| PubChem CID | 166564865 |
| Molecular Formula | C22H46N2 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.37 |
| IUPAC Name | 7-(3-tert-butylpiperidin-1-yl)-N-(3,3-dimethylbutyl)heptan-1-amine |
| SMILES | CC(C)(C)CCNCCCCCCCN1CCCC(C(C)(C)C)C1 |
| InChI | InChI=1S/C22H46N2/c1-21(2,3)14-16-23-15-10-8-7-9-11-17-24-18-12-13-20(19-24)22(4,5)6/h20,23H,7-19H2,1-6H3 |
| InChIKey | CJYREUGJDHTLBY-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|