C12H23F3N2O — CID 62574425
3-methoxy-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]propan-1-amine (PubChem CID 62574425) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-methoxy-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]propan-1-amine.
| Compound Name | 3-methoxy-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 62574425 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-methoxy-N-[2-[3-(trifluoromethyl)piperidin-1-yl]ethyl]propan-1-amine |
| SMILES | COCCCNCCN1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H23F3N2O/c1-18-9-3-5-16-6-8-17-7-2-4-11(10-17)12(13,14)15/h11,16H,2-10H2,1H3 |
| InChIKey | QMUPCGFGUMFNDA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|