C8H18BrIN2 — CID 21465026
1-(2-bromoethyl)-1,4-dimethylpiperazin-1-ium iodide (PubChem CID 21465026) has the molecular formula C8H18BrIN2 and a molecular weight of 349.05 g/mol. Its IUPAC name is 1-(2-bromoethyl)-1,4-dimethylpiperazin-1-ium iodide.
| Compound Name | 1-(2-bromoethyl)-1,4-dimethylpiperazin-1-ium iodide |
|---|---|
| PubChem CID | 21465026 |
| Molecular Formula | C8H18BrIN2 |
| Molecular Weight | 349.05 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 1-(2-bromoethyl)-1,4-dimethylpiperazin-1-ium iodide |
| SMILES | CN1CC[N+](C)(CCBr)CC1.[I-] |
| InChI | InChI=1S/C8H18BrN2.HI/c1-10-4-7-11(2,6-3-9)8-5-10;/h3-8H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CVQZPKCRCDSHHK-UHFFFAOYSA-M |
| XLogP | -2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.05 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|