C10H21Br2N2+ — CID 57106327
1-(1,3-dibromobutyl)-1,4-dimethylpiperazin-1-ium (PubChem CID 57106327) has the molecular formula C10H21Br2N2+ and a molecular weight of 329.10 g/mol. Its IUPAC name is 1-(1,3-dibromobutyl)-1,4-dimethylpiperazin-1-ium.
| Compound Name | 1-(1,3-dibromobutyl)-1,4-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 57106327 |
| Molecular Formula | C10H21Br2N2+ |
| Molecular Weight | 329.10 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 1-(1,3-dibromobutyl)-1,4-dimethylpiperazin-1-ium |
| SMILES | CC(Br)CC(Br)[N+]1(C)CCN(C)CC1 |
| InChI | InChI=1S/C10H21Br2N2/c1-9(11)8-10(12)14(3)6-4-13(2)5-7-14/h9-10H,4-8H2,1-3H3/q+1 |
| InChIKey | UECPEZLCYSANTN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.10 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|