C10H22BrN2+ — CID 20689005
1-(3-bromobutyl)-1,4-dimethylpiperazin-1-ium (PubChem CID 20689005) has the molecular formula C10H22BrN2+ and a molecular weight of 250.20 g/mol. Its IUPAC name is 1-(3-bromobutyl)-1,4-dimethylpiperazin-1-ium.
| Compound Name | 1-(3-bromobutyl)-1,4-dimethylpiperazin-1-ium |
|---|---|
| PubChem CID | 20689005 |
| Molecular Formula | C10H22BrN2+ |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(3-bromobutyl)-1,4-dimethylpiperazin-1-ium |
| SMILES | CC(Br)CC[N+]1(C)CCN(C)CC1 |
| InChI | InChI=1S/C10H22BrN2/c1-10(11)4-7-13(3)8-5-12(2)6-9-13/h10H,4-9H2,1-3H3/q+1 |
| InChIKey | SPPJYBQSLUTAQW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|