About 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten
1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten (PubChem CID 158402178) has the molecular formula C12H27N2W+
and a molecular weight of 383.20 g/mol. Its IUPAC name is 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten.
Molecular Properties
| Compound Name | 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten |
| PubChem CID | 158402178 |
| Molecular Formula | C12H27N2W+ |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten |
| SMILES | CN1CCCC1.C[N+]1(C)CCCCC1.[W] |
| InChI | InChI=1S/C7H16N.C5H11N.W/c1-8(2)6-4-3-5-7-8;1-6-4-2-3-5-6;/h3-7H2,1-2H3;2-5H2,1H3;/q+1;; |
| InChIKey | VQQYCHMLDGUJNT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten?
The IUPAC name of 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten (CID 158402178) is 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten.
What is the SMILES notation for 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten?
The canonical SMILES for 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten is CN1CCCC1.C[N+]1(C)CCCCC1.[W].
What is the InChIKey of 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten?
The InChIKey is VQQYCHMLDGUJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N.C5H11N.W/c1-8(2)6-4-3-5-7-8;1-6-4-2-3-5-6;/h3-7H2,1-2H3;2-5H2,1H3;/q+1;;.
What are the key properties of 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten?
1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten has a molecular weight of 383.20 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylpiperidin-1-ium;1-methylpyrrolidine;tungsten is sourced from PubChem (CID 158402178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).