C21H46N2+2 — CID 54262537
1-ethyl-1,9,9-trimethyl-1,9-diazoniacyclooctadecane (PubChem CID 54262537) has the molecular formula C21H46N2+2 and a molecular weight of 326.61 g/mol. Its IUPAC name is 1-ethyl-1,9,9-trimethyl-1,9-diazoniacyclooctadecane.
| Compound Name | 1-ethyl-1,9,9-trimethyl-1,9-diazoniacyclooctadecane |
|---|---|
| PubChem CID | 54262537 |
| Molecular Formula | C21H46N2+2 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.37 |
| IUPAC Name | 1-ethyl-1,9,9-trimethyl-1,9-diazoniacyclooctadecane |
| SMILES | CC[N+]1(C)CCCCCCCCC[N+](C)(C)CCCCCCC1 |
| InChI | InChI=1S/C21H46N2/c1-5-23(4)20-16-12-8-6-7-10-14-18-22(2,3)19-15-11-9-13-17-21-23/h5-21H2,1-4H3/q+2 |
| InChIKey | RENGZOPBCCWJIZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|