C11H15NaO3S — CID 122461988
sodium;prop-2-ene-1-sulfonate;1,2-xylene (PubChem CID 122461988) has the molecular formula C11H15NaO3S and a molecular weight of 250.29 g/mol. Its IUPAC name is sodium;prop-2-ene-1-sulfonate;1,2-xylene.
| Compound Name | sodium;prop-2-ene-1-sulfonate;1,2-xylene |
|---|---|
| PubChem CID | 122461988 |
| Molecular Formula | C11H15NaO3S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | sodium;prop-2-ene-1-sulfonate;1,2-xylene |
| SMILES | C=CCS(=O)(=O)[O-].Cc1ccccc1C.[Na+] |
| InChI | InChI=1S/C8H10.C3H6O3S.Na/c1-7-5-3-4-6-8(7)2;1-2-3-7(4,5)6;/h3-6H,1-2H3;2H,1,3H2,(H,4,5,6);/q;;+1/p-1 |
| InChIKey | YMVUVYBBSXQUKV-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|