About sodium;prop-2-ene-1-sulfonate;1,2-xylene
sodium;prop-2-ene-1-sulfonate;1,2-xylene (PubChem CID 122461988) has the molecular formula C11H15NaO3S
and a molecular weight of 250.29 g/mol. Its IUPAC name is sodium;prop-2-ene-1-sulfonate;1,2-xylene.
Molecular Properties
| Compound Name | sodium;prop-2-ene-1-sulfonate;1,2-xylene |
| PubChem CID | 122461988 |
| Molecular Formula | C11H15NaO3S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | sodium;prop-2-ene-1-sulfonate;1,2-xylene |
| SMILES | C=CCS(=O)(=O)[O-].Cc1ccccc1C.[Na+] |
| InChI | InChI=1S/C8H10.C3H6O3S.Na/c1-7-5-3-4-6-8(7)2;1-2-3-7(4,5)6;/h3-6H,1-2H3;2H,1,3H2,(H,4,5,6);/q;;+1/p-1 |
| InChIKey | YMVUVYBBSXQUKV-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;prop-2-ene-1-sulfonate;1,2-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;prop-2-ene-1-sulfonate;1,2-xylene?
The IUPAC name of sodium;prop-2-ene-1-sulfonate;1,2-xylene (CID 122461988) is sodium;prop-2-ene-1-sulfonate;1,2-xylene.
What is the SMILES notation for sodium;prop-2-ene-1-sulfonate;1,2-xylene?
The canonical SMILES for sodium;prop-2-ene-1-sulfonate;1,2-xylene is C=CCS(=O)(=O)[O-].Cc1ccccc1C.[Na+].
What is the InChIKey of sodium;prop-2-ene-1-sulfonate;1,2-xylene?
The InChIKey is YMVUVYBBSXQUKV-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10.C3H6O3S.Na/c1-7-5-3-4-6-8(7)2;1-2-3-7(4,5)6;/h3-6H,1-2H3;2H,1,3H2,(H,4,5,6);/q;;+1/p-1.
What are the key properties of sodium;prop-2-ene-1-sulfonate;1,2-xylene?
sodium;prop-2-ene-1-sulfonate;1,2-xylene has a molecular weight of 250.29 g/mol, XLogP of -0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;prop-2-ene-1-sulfonate;1,2-xylene is sourced from PubChem (CID 122461988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).