C27H25O3PS — CID 87367569
prop-2-ene-1-sulfonate;tetraphenylphosphanium (PubChem CID 87367569) has the molecular formula C27H25O3PS and a molecular weight of 460.54 g/mol. Its IUPAC name is prop-2-ene-1-sulfonate;tetraphenylphosphanium.
| Compound Name | prop-2-ene-1-sulfonate;tetraphenylphosphanium |
|---|---|
| PubChem CID | 87367569 |
| Molecular Formula | C27H25O3PS |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | prop-2-ene-1-sulfonate;tetraphenylphosphanium |
| SMILES | C=CCS(=O)(=O)[O-].c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C3H6O3S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-3-7(4,5)6/h1-20H;2H,1,3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | FBLRFAPUVSXARK-UHFFFAOYSA-M |
| XLogP | 4.02 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|