C32H27O3PS — CID 87934174
4-ethenylbenzenesulfonate;tetraphenylphosphanium (PubChem CID 87934174) has the molecular formula C32H27O3PS and a molecular weight of 522.61 g/mol. Its IUPAC name is 4-ethenylbenzenesulfonate;tetraphenylphosphanium.
| Compound Name | 4-ethenylbenzenesulfonate;tetraphenylphosphanium |
|---|---|
| PubChem CID | 87934174 |
| Molecular Formula | C32H27O3PS |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 4-ethenylbenzenesulfonate;tetraphenylphosphanium |
| SMILES | C=Cc1ccc(S(=O)(=O)[O-])cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20P.C8H8O3S/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-2-7-3-5-8(6-4-7)12(9,10)11/h1-20H;2-6H,1H2,(H,9,10,11)/q+1;/p-1 |
| InChIKey | LKYXQCNKHKXTSF-UHFFFAOYSA-M |
| XLogP | 5.54 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|