C54H44N2O6P2S2 — CID 139040502
N-(4-sulfonatoiminocyclohexa-2,5-dien-1-ylidene)sulfamate;bis(tetraphenylphosphanium) (PubChem CID 139040502) has the molecular formula C54H44N2O6P2S2 and a molecular weight of 943.04 g/mol. Its IUPAC name is N-(4-sulfonatoiminocyclohexa-2,5-dien-1-ylidene)sulfamate;bis(tetraphenylphosphanium).
| Compound Name | N-(4-sulfonatoiminocyclohexa-2,5-dien-1-ylidene)sulfamate;bis(tetraphenylphosphanium) |
|---|---|
| PubChem CID | 139040502 |
| Molecular Formula | C54H44N2O6P2S2 |
| Molecular Weight | 943.04 g/mol |
| Exact Mass | 942.21 |
| IUPAC Name | N-(4-sulfonatoiminocyclohexa-2,5-dien-1-ylidene)sulfamate;bis(tetraphenylphosphanium) |
| SMILES | O=S(=O)([O-])N=C1C=CC(=NS(=O)(=O)[O-])C=C1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C24H20P.C6H6N2O6S2/c2*1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;9-15(10,11)7-5-1-2-6(4-3-5)8-16(12,13)14/h2*1-20H;1-4H,(H,9,10,11)(H,12,13,14)/q2*+1;/p-2/b;;7-5-,8-6+ |
| InChIKey | QPTNGZXIBYWMAC-BCKPACDASA-L |
| XLogP | 7.53 |
| TPSA | 139.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.04 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|