About cesium;hydride;prop-2-ene-1-sulfonic acid
cesium;hydride;prop-2-ene-1-sulfonic acid (PubChem CID 173073935) has the molecular formula C3H7CsO3S
and a molecular weight of 256.06 g/mol. Its IUPAC name is cesium;hydride;prop-2-ene-1-sulfonic acid.
Molecular Properties
| Compound Name | cesium;hydride;prop-2-ene-1-sulfonic acid |
| PubChem CID | 173073935 |
| Molecular Formula | C3H7CsO3S |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 255.92 |
| IUPAC Name | cesium;hydride;prop-2-ene-1-sulfonic acid |
| SMILES | C=CCS(=O)(=O)O.[Cs+].[H-] |
| InChI | InChI=1S/C3H6O3S.Cs.H/c1-2-3-7(4,5)6;;/h2H,1,3H2,(H,4,5,6);;/q;+1;-1 |
| InChIKey | SRSFEUVXZOLEPP-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cesium;hydride;prop-2-ene-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium;hydride;prop-2-ene-1-sulfonic acid?
The IUPAC name of cesium;hydride;prop-2-ene-1-sulfonic acid (CID 173073935) is cesium;hydride;prop-2-ene-1-sulfonic acid.
What is the SMILES notation for cesium;hydride;prop-2-ene-1-sulfonic acid?
The canonical SMILES for cesium;hydride;prop-2-ene-1-sulfonic acid is C=CCS(=O)(=O)O.[Cs+].[H-].
What is the InChIKey of cesium;hydride;prop-2-ene-1-sulfonic acid?
The InChIKey is SRSFEUVXZOLEPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3S.Cs.H/c1-2-3-7(4,5)6;;/h2H,1,3H2,(H,4,5,6);;/q;+1;-1.
What are the key properties of cesium;hydride;prop-2-ene-1-sulfonic acid?
cesium;hydride;prop-2-ene-1-sulfonic acid has a molecular weight of 256.06 g/mol, XLogP of -2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cesium;hydride;prop-2-ene-1-sulfonic acid is sourced from PubChem (CID 173073935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).