C14H32NO3S+ — CID 88536950
prop-2-ene-1-sulfonic acid;trimethyl(octyl)azanium (PubChem CID 88536950) has the molecular formula C14H32NO3S+ and a molecular weight of 294.48 g/mol. Its IUPAC name is prop-2-ene-1-sulfonic acid;trimethyl(octyl)azanium.
| Compound Name | prop-2-ene-1-sulfonic acid;trimethyl(octyl)azanium |
|---|---|
| PubChem CID | 88536950 |
| Molecular Formula | C14H32NO3S+ |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | prop-2-ene-1-sulfonic acid;trimethyl(octyl)azanium |
| SMILES | C=CCS(=O)(=O)O.CCCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C11H26N.C3H6O3S/c1-5-6-7-8-9-10-11-12(2,3)4;1-2-3-7(4,5)6/h5-11H2,1-4H3;2H,1,3H2,(H,4,5,6)/q+1; |
| InChIKey | TUNBDZLQBWZOEK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|