C6H11NaO3S — CID 88807724
sodium;prop-1-ene;prop-2-ene-1-sulfonic acid (PubChem CID 88807724) has the molecular formula C6H11NaO3S and a molecular weight of 186.21 g/mol. Its IUPAC name is sodium;prop-1-ene;prop-2-ene-1-sulfonic acid.
| Compound Name | sodium;prop-1-ene;prop-2-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 88807724 |
| Molecular Formula | C6H11NaO3S |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | sodium;prop-1-ene;prop-2-ene-1-sulfonic acid |
| SMILES | C=CCS(=O)(=O)O.C=C[CH2-].[Na+] |
| InChI | InChI=1S/C3H6O3S.C3H5.Na/c1-2-3-7(4,5)6;1-3-2;/h2H,1,3H2,(H,4,5,6);3H,1-2H2;/q;-1;+1 |
| InChIKey | HBZPPHVSFHPIOJ-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|