About sodium;prop-2-ene-1-sulfonic acid;trifluoromethane
sodium;prop-2-ene-1-sulfonic acid;trifluoromethane (PubChem CID 174596418) has the molecular formula C4H6F3NaO3S
and a molecular weight of 214.14 g/mol. Its IUPAC name is sodium;prop-2-ene-1-sulfonic acid;trifluoromethane.
Molecular Properties
| Compound Name | sodium;prop-2-ene-1-sulfonic acid;trifluoromethane |
| PubChem CID | 174596418 |
| Molecular Formula | C4H6F3NaO3S |
| Molecular Weight | 214.14 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | sodium;prop-2-ene-1-sulfonic acid;trifluoromethane |
| SMILES | C=CCS(=O)(=O)O.F[C-](F)F.[Na+] |
| InChI | InChI=1S/C3H6O3S.CF3.Na/c1-2-3-7(4,5)6;2-1(3)4;/h2H,1,3H2,(H,4,5,6);;/q;-1;+1 |
| InChIKey | XSNVUASVWRRITQ-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.14 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;prop-2-ene-1-sulfonic acid;trifluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;prop-2-ene-1-sulfonic acid;trifluoromethane?
The IUPAC name of sodium;prop-2-ene-1-sulfonic acid;trifluoromethane (CID 174596418) is sodium;prop-2-ene-1-sulfonic acid;trifluoromethane.
What is the SMILES notation for sodium;prop-2-ene-1-sulfonic acid;trifluoromethane?
The canonical SMILES for sodium;prop-2-ene-1-sulfonic acid;trifluoromethane is C=CCS(=O)(=O)O.F[C-](F)F.[Na+].
What is the InChIKey of sodium;prop-2-ene-1-sulfonic acid;trifluoromethane?
The InChIKey is XSNVUASVWRRITQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3S.CF3.Na/c1-2-3-7(4,5)6;2-1(3)4;/h2H,1,3H2,(H,4,5,6);;/q;-1;+1.
What are the key properties of sodium;prop-2-ene-1-sulfonic acid;trifluoromethane?
sodium;prop-2-ene-1-sulfonic acid;trifluoromethane has a molecular weight of 214.14 g/mol, XLogP of -1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;prop-2-ene-1-sulfonic acid;trifluoromethane is sourced from PubChem (CID 174596418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).