About 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol
4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol (PubChem CID 175582028) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol.
Molecular Properties
| Compound Name | 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol |
| PubChem CID | 175582028 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol |
| SMILES | C=C(CCO)C(N)=O.OCCC=Cc1ccccc1 |
| InChI | InChI=1S/C10H12O.C5H9NO2/c11-9-5-4-8-10-6-2-1-3-7-10;1-4(2-3-7)5(6)8/h1-4,6-8,11H,5,9H2;7H,1-3H2,(H2,6,8) |
| InChIKey | XQHYIXHTHHDYPK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol?
The IUPAC name of 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol (CID 175582028) is 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol.
What is the SMILES notation for 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol?
The canonical SMILES for 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol is C=C(CCO)C(N)=O.OCCC=Cc1ccccc1.
What is the InChIKey of 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol?
The InChIKey is XQHYIXHTHHDYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C5H9NO2/c11-9-5-4-8-10-6-2-1-3-7-10;1-4(2-3-7)5(6)8/h1-4,6-8,11H,5,9H2;7H,1-3H2,(H2,6,8).
What are the key properties of 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol?
4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol has a molecular weight of 263.34 g/mol, XLogP of 1.49, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2-methylidenebutanamide;4-phenylbut-3-en-1-ol is sourced from PubChem (CID 175582028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).