About 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine
3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine (PubChem CID 173369004) has the molecular formula C14H20ClNO2
and a molecular weight of 269.77 g/mol. Its IUPAC name is 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine.
Molecular Properties
| Compound Name | 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine |
| PubChem CID | 173369004 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine |
| SMILES | NCCCC=Cc1ccccc1.O=C(Cl)CCO |
| InChI | InChI=1S/C11H15N.C3H5ClO2/c12-10-6-2-5-9-11-7-3-1-4-8-11;4-3(6)1-2-5/h1,3-5,7-9H,2,6,10,12H2;5H,1-2H2 |
| InChIKey | OFSVIUAZCLJJSW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine?
The IUPAC name of 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine (CID 173369004) is 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine.
What is the SMILES notation for 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine?
The canonical SMILES for 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine is NCCCC=Cc1ccccc1.O=C(Cl)CCO.
What is the InChIKey of 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine?
The InChIKey is OFSVIUAZCLJJSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C3H5ClO2/c12-10-6-2-5-9-11-7-3-1-4-8-11;4-3(6)1-2-5/h1,3-5,7-9H,2,6,10,12H2;5H,1-2H2.
What are the key properties of 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine?
3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine has a molecular weight of 269.77 g/mol, XLogP of 2.57, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropanoyl chloride;5-phenylpent-4-en-1-amine is sourced from PubChem (CID 173369004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).