C14H20N2O4 — CID 7541582
N-(2,2-dimethoxyethyl)-N'-(4-ethylphenyl)oxamide (PubChem CID 7541582) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N'-(4-ethylphenyl)oxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N'-(4-ethylphenyl)oxamide |
|---|---|
| PubChem CID | 7541582 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N'-(4-ethylphenyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NCC(OC)OC)cc1 |
| InChI | InChI=1S/C14H20N2O4/c1-4-10-5-7-11(8-6-10)16-14(18)13(17)15-9-12(19-2)20-3/h5-8,12H,4,9H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | DFBZWWMWWDARBG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|