C26H54Cl2N6O8 — CID 21156309
[2-[2-aminoethyl-[1,2-bis(butylcarbamoyloxy)ethyl]amino]-2-(butylcarbamoyloxy)ethyl] N-butylcarbamate;dihydrochloride (PubChem CID 21156309) has the molecular formula C26H54Cl2N6O8 and a molecular weight of 649.66 g/mol. Its IUPAC name is [2-[2-aminoethyl-[1,2-bis(butylcarbamoyloxy)ethyl]amino]-2-(butylcarbamoyloxy)ethyl] N-butylcarbamate;dihydrochloride.
| Compound Name | [2-[2-aminoethyl-[1,2-bis(butylcarbamoyloxy)ethyl]amino]-2-(butylcarbamoyloxy)ethyl] N-butylcarbamate;dihydrochloride |
|---|---|
| PubChem CID | 21156309 |
| Molecular Formula | C26H54Cl2N6O8 |
| Molecular Weight | 649.66 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | [2-[2-aminoethyl-[1,2-bis(butylcarbamoyloxy)ethyl]amino]-2-(butylcarbamoyloxy)ethyl] N-butylcarbamate;dihydrochloride |
| SMILES | CCCCNC(=O)OCC(OC(=O)NCCCC)N(CCN)C(COC(=O)NCCCC)OC(=O)NCCCC.Cl.Cl |
| InChI | InChI=1S/C26H52N6O8.2ClH/c1-5-9-14-28-23(33)37-19-21(39-25(35)30-16-11-7-3)32(18-13-27)22(40-26(36)31-17-12-8-4)20-38-24(34)29-15-10-6-2;;/h21-22H,5-20,27H2,1-4H3,(H,28,33)(H,29,34)(H,30,35)(H,31,36);2*1H |
| InChIKey | CNEQNEVHDIGGTA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 182.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|