About hexan-3-yl N-(6-aminohexyl)carbamate
hexan-3-yl N-(6-aminohexyl)carbamate (PubChem CID 89385882) has the molecular formula C13H28N2O2
and a molecular weight of 244.38 g/mol. Its IUPAC name is hexan-3-yl N-(6-aminohexyl)carbamate.
Molecular Properties
| Compound Name | hexan-3-yl N-(6-aminohexyl)carbamate |
| PubChem CID | 89385882 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | hexan-3-yl N-(6-aminohexyl)carbamate |
| SMILES | CCCC(CC)OC(=O)NCCCCCCN |
| InChI | InChI=1S/C13H28N2O2/c1-3-9-12(4-2)17-13(16)15-11-8-6-5-7-10-14/h12H,3-11,14H2,1-2H3,(H,15,16) |
| InChIKey | BZSWSOZARVYZAJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexan-3-yl N-(6-aminohexyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-yl N-(6-aminohexyl)carbamate?
The IUPAC name of hexan-3-yl N-(6-aminohexyl)carbamate (CID 89385882) is hexan-3-yl N-(6-aminohexyl)carbamate.
What is the SMILES notation for hexan-3-yl N-(6-aminohexyl)carbamate?
The canonical SMILES for hexan-3-yl N-(6-aminohexyl)carbamate is CCCC(CC)OC(=O)NCCCCCCN.
What is the InChIKey of hexan-3-yl N-(6-aminohexyl)carbamate?
The InChIKey is BZSWSOZARVYZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O2/c1-3-9-12(4-2)17-13(16)15-11-8-6-5-7-10-14/h12H,3-11,14H2,1-2H3,(H,15,16).
What are the key properties of hexan-3-yl N-(6-aminohexyl)carbamate?
hexan-3-yl N-(6-aminohexyl)carbamate has a molecular weight of 244.38 g/mol, XLogP of 2.81, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-yl N-(6-aminohexyl)carbamate is sourced from PubChem (CID 89385882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).