C20H39N3O15P2 — CID 154990097
[4-[5-[[2-(ethylcarbamoyloxy)-3-propanoyloxypropoxy]carbonylamino]pentoxycarbonylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid (PubChem CID 154990097) has the molecular formula C20H39N3O15P2 and a molecular weight of 623.49 g/mol. Its IUPAC name is [4-[5-[[2-(ethylcarbamoyloxy)-3-propanoyloxypropoxy]carbonylamino]pentoxycarbonylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid.
| Compound Name | [4-[5-[[2-(ethylcarbamoyloxy)-3-propanoyloxypropoxy]carbonylamino]pentoxycarbonylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 154990097 |
| Molecular Formula | C20H39N3O15P2 |
| Molecular Weight | 623.49 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | [4-[5-[[2-(ethylcarbamoyloxy)-3-propanoyloxypropoxy]carbonylamino]pentoxycarbonylamino]-1-hydroxy-1-phosphonobutyl]phosphonic acid |
| SMILES | CCNC(=O)OC(COC(=O)CC)COC(=O)NCCCCCOC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C20H39N3O15P2/c1-3-16(24)36-13-15(38-19(27)21-4-2)14-37-18(26)22-10-6-5-7-12-35-17(25)23-11-8-9-20(28,39(29,30)31)40(32,33)34/h15,28H,3-14H2,1-2H3,(H,21,27)(H,22,26)(H,23,25)(H2,29,30,31)(H2,32,33,34) |
| InChIKey | USVSWHYYEBCIIG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 276.58 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|