C28H54N2O15P2 — CID 135196581
[1-hydroxy-4-[5-[[3-(2-methylbutanoyloxy)-2-(2,2,4,4-tetramethylpentanoyloxy)propoxy]carbonylamino]pentoxycarbonylamino]-1-phosphonobutyl]phosphonic acid (PubChem CID 135196581) has the molecular formula C28H54N2O15P2 and a molecular weight of 720.69 g/mol. Its IUPAC name is [1-hydroxy-4-[5-[[3-(2-methylbutanoyloxy)-2-(2,2,4,4-tetramethylpentanoyloxy)propoxy]carbonylamino]pentoxycarbonylamino]-1-phosphonobutyl]phosphonic acid.
| Compound Name | [1-hydroxy-4-[5-[[3-(2-methylbutanoyloxy)-2-(2,2,4,4-tetramethylpentanoyloxy)propoxy]carbonylamino]pentoxycarbonylamino]-1-phosphonobutyl]phosphonic acid |
|---|---|
| PubChem CID | 135196581 |
| Molecular Formula | C28H54N2O15P2 |
| Molecular Weight | 720.69 g/mol |
| Exact Mass | 720.30 |
| IUPAC Name | [1-hydroxy-4-[5-[[3-(2-methylbutanoyloxy)-2-(2,2,4,4-tetramethylpentanoyloxy)propoxy]carbonylamino]pentoxycarbonylamino]-1-phosphonobutyl]phosphonic acid |
| SMILES | CCC(C)C(=O)OCC(COC(=O)NCCCCCOC(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O)OC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C28H54N2O15P2/c1-8-20(2)22(31)43-17-21(45-23(32)27(6,7)19-26(3,4)5)18-44-25(34)29-14-10-9-11-16-42-24(33)30-15-12-13-28(35,46(36,37)38)47(39,40)41/h20-21,35H,8-19H2,1-7H3,(H,29,34)(H,30,33)(H2,36,37,38)(H2,39,40,41) |
| InChIKey | SUSJARLAVNDVBN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 264.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|