C41H78N2O12 — CID 123556129
[3-[2-[2-[2-[[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butoxy]carbonylamino]ethoxy]ethoxy]ethylcarbamoyloxy]-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylhexanoate (PubChem CID 123556129) has the molecular formula C41H78N2O12 and a molecular weight of 791.08 g/mol. Its IUPAC name is [3-[2-[2-[2-[[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butoxy]carbonylamino]ethoxy]ethoxy]ethylcarbamoyloxy]-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylhexanoate.
| Compound Name | [3-[2-[2-[2-[[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butoxy]carbonylamino]ethoxy]ethoxy]ethylcarbamoyloxy]-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylhexanoate |
|---|---|
| PubChem CID | 123556129 |
| Molecular Formula | C41H78N2O12 |
| Molecular Weight | 791.08 g/mol |
| Exact Mass | 790.56 |
| IUPAC Name | [3-[2-[2-[2-[[3-methyl-3-[2-[(2-methylpropan-2-yl)oxy]ethoxy]butoxy]carbonylamino]ethoxy]ethoxy]ethylcarbamoyloxy]-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylhexanoate |
| SMILES | CCC(C)(C)CC(C)(C)C(=O)OCC(COC(=O)NCCOCCOCCNC(=O)OCCC(C)(C)OCCOC(C)(C)C)OC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C41H78N2O12/c1-16-38(8,9)30-40(12,13)32(44)51-27-31(55-33(45)39(10,11)29-36(2,3)4)28-52-35(47)43-19-22-49-24-23-48-21-18-42-34(46)50-20-17-41(14,15)54-26-25-53-37(5,6)7/h31H,16-30H2,1-15H3,(H,42,46)(H,43,47) |
| InChIKey | YACYFYLUXITALJ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.08 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|