C33H60O6 — CID 135188438
2,3-bis(2,2,4,4-tetramethylpentanoyloxy)propyl (E)-2,2,4,4-tetramethyloct-5-enoate (PubChem CID 135188438) has the molecular formula C33H60O6 and a molecular weight of 552.84 g/mol. Its IUPAC name is 2,3-bis(2,2,4,4-tetramethylpentanoyloxy)propyl (E)-2,2,4,4-tetramethyloct-5-enoate.
| Compound Name | 2,3-bis(2,2,4,4-tetramethylpentanoyloxy)propyl (E)-2,2,4,4-tetramethyloct-5-enoate |
|---|---|
| PubChem CID | 135188438 |
| Molecular Formula | C33H60O6 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.44 |
| IUPAC Name | 2,3-bis(2,2,4,4-tetramethylpentanoyloxy)propyl (E)-2,2,4,4-tetramethyloct-5-enoate |
| SMILES | CC/C=C/C(C)(C)CC(C)(C)C(=O)OCC(COC(=O)C(C)(C)CC(C)(C)C)OC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C33H60O6/c1-16-17-18-30(8,9)23-33(14,15)26(35)38-20-24(39-27(36)32(12,13)22-29(5,6)7)19-37-25(34)31(10,11)21-28(2,3)4/h17-18,24H,16,19-23H2,1-15H3/b18-17+ |
| InChIKey | QSDBAZKIYTWJCH-ISLYRVAYSA-N |
| XLogP | 8.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|