C28H50O4 — CID 134605814
(1-ethoxy-3-methyl-1-oxopentan-2-yl) (5Z,8Z)-2,2,4,4,10,12,12-heptamethyltrideca-5,8-dienoate (PubChem CID 134605814) has the molecular formula C28H50O4 and a molecular weight of 450.70 g/mol. Its IUPAC name is (1-ethoxy-3-methyl-1-oxopentan-2-yl) (5Z,8Z)-2,2,4,4,10,12,12-heptamethyltrideca-5,8-dienoate.
| Compound Name | (1-ethoxy-3-methyl-1-oxopentan-2-yl) (5Z,8Z)-2,2,4,4,10,12,12-heptamethyltrideca-5,8-dienoate |
|---|---|
| PubChem CID | 134605814 |
| Molecular Formula | C28H50O4 |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | (1-ethoxy-3-methyl-1-oxopentan-2-yl) (5Z,8Z)-2,2,4,4,10,12,12-heptamethyltrideca-5,8-dienoate |
| SMILES | CCOC(=O)C(OC(=O)C(C)(C)CC(C)(C)/C=C\C/C=C\C(C)CC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C28H50O4/c1-12-22(4)23(24(29)31-13-2)32-25(30)28(10,11)20-27(8,9)18-16-14-15-17-21(3)19-26(5,6)7/h15-18,21-23H,12-14,19-20H2,1-11H3/b17-15-,18-16- |
| InChIKey | MGWLEAASJRZYGS-IQRFGFHNSA-N |
| XLogP | 7.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|