C32H62NO11P — CID 167214640
[3-[hydroxy-[2-[[2-(2-methoxy-2-methylpropoxy)-2-methylpropanoyl]amino]ethoxy]phosphoryl]oxy-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate (PubChem CID 167214640) has the molecular formula C32H62NO11P and a molecular weight of 667.82 g/mol. Its IUPAC name is [3-[hydroxy-[2-[[2-(2-methoxy-2-methylpropoxy)-2-methylpropanoyl]amino]ethoxy]phosphoryl]oxy-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate.
| Compound Name | [3-[hydroxy-[2-[[2-(2-methoxy-2-methylpropoxy)-2-methylpropanoyl]amino]ethoxy]phosphoryl]oxy-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 167214640 |
| Molecular Formula | C32H62NO11P |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.41 |
| IUPAC Name | [3-[hydroxy-[2-[[2-(2-methoxy-2-methylpropoxy)-2-methylpropanoyl]amino]ethoxy]phosphoryl]oxy-2-(2,2,4,4-tetramethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate |
| SMILES | COC(C)(C)COC(C)(C)C(=O)NCCOP(=O)(O)OCC(COC(=O)C(C)(C)CC(C)(C)C)OC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C32H62NO11P/c1-27(2,3)20-29(7,8)25(35)40-18-23(44-26(36)30(9,10)21-28(4,5)6)19-43-45(37,38)42-17-16-33-24(34)32(13,14)41-22-31(11,12)39-15/h23H,16-22H2,1-15H3,(H,33,34)(H,37,38) |
| InChIKey | LJUPTOKUAPIYIO-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|