C11H19I2N2O10P — CID 149326181
[1-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-3-carboniodidoyloxypropan-2-yl] carboniodidate (PubChem CID 149326181) has the molecular formula C11H19I2N2O10P and a molecular weight of 624.06 g/mol. Its IUPAC name is [1-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-3-carboniodidoyloxypropan-2-yl] carboniodidate.
| Compound Name | [1-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-3-carboniodidoyloxypropan-2-yl] carboniodidate |
|---|---|
| PubChem CID | 149326181 |
| Molecular Formula | C11H19I2N2O10P |
| Molecular Weight | 624.06 g/mol |
| Exact Mass | 623.89 |
| IUPAC Name | [1-[2-[[2-(2-aminoethoxy)acetyl]amino]ethoxy-hydroxyphosphoryl]oxy-3-carboniodidoyloxypropan-2-yl] carboniodidate |
| SMILES | NCCOCC(=O)NCCOP(=O)(O)OCC(COC(=O)I)OC(=O)I |
| InChI | InChI=1S/C11H19I2N2O10P/c12-10(17)22-5-8(25-11(13)18)6-24-26(19,20)23-4-2-15-9(16)7-21-3-1-14/h8H,1-7,14H2,(H,15,16)(H,19,20) |
| InChIKey | YBKJEGCEBTUGKI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 172.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.06 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|