C20H33NO8 — CID 161281078
[3-(2-methoxyethylcarbamoyloxy)-2-(4-oxooct-7-ynoxy)propyl] 4-methoxybutanoate (PubChem CID 161281078) has the molecular formula C20H33NO8 and a molecular weight of 415.48 g/mol. Its IUPAC name is [3-(2-methoxyethylcarbamoyloxy)-2-(4-oxooct-7-ynoxy)propyl] 4-methoxybutanoate.
| Compound Name | [3-(2-methoxyethylcarbamoyloxy)-2-(4-oxooct-7-ynoxy)propyl] 4-methoxybutanoate |
|---|---|
| PubChem CID | 161281078 |
| Molecular Formula | C20H33NO8 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | [3-(2-methoxyethylcarbamoyloxy)-2-(4-oxooct-7-ynoxy)propyl] 4-methoxybutanoate |
| SMILES | C#CCCC(=O)CCCOC(COC(=O)CCCOC)COC(=O)NCCOC |
| InChI | InChI=1S/C20H33NO8/c1-4-5-8-17(22)9-6-13-27-18(15-28-19(23)10-7-12-25-2)16-29-20(24)21-11-14-26-3/h1,18H,5-16H2,2-3H3,(H,21,24) |
| InChIKey | DFDXDOCASDCVCB-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|