C17H25N2O9PS2 — CID 143952246
[2-acetyloxy-3-[hydroxy-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]phosphoryl]oxypropyl] acetate (PubChem CID 143952246) has the molecular formula C17H25N2O9PS2 and a molecular weight of 496.50 g/mol. Its IUPAC name is [2-acetyloxy-3-[hydroxy-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]phosphoryl]oxypropyl] acetate.
| Compound Name | [2-acetyloxy-3-[hydroxy-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]phosphoryl]oxypropyl] acetate |
|---|---|
| PubChem CID | 143952246 |
| Molecular Formula | C17H25N2O9PS2 |
| Molecular Weight | 496.50 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | [2-acetyloxy-3-[hydroxy-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]phosphoryl]oxypropyl] acetate |
| SMILES | CC(=O)OCC(COP(=O)(O)OCCNC(=O)CCSSc1ccccn1)OC(C)=O |
| InChI | InChI=1S/C17H25N2O9PS2/c1-13(20)25-11-15(28-14(2)21)12-27-29(23,24)26-9-8-18-16(22)6-10-30-31-17-5-3-4-7-19-17/h3-5,7,15H,6,8-12H2,1-2H3,(H,18,22)(H,23,24) |
| InChIKey | FUNRXFKGIANMCS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.50 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|