C16H30NO10P — CID 154573919
(2S)-3-[[(2R)-3-acetyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-aminopropanoic acid (PubChem CID 154573919) has the molecular formula C16H30NO10P and a molecular weight of 427.39 g/mol. Its IUPAC name is (2S)-3-[[(2R)-3-acetyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-aminopropanoic acid.
| Compound Name | (2S)-3-[[(2R)-3-acetyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-aminopropanoic acid |
|---|---|
| PubChem CID | 154573919 |
| Molecular Formula | C16H30NO10P |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (2S)-3-[[(2R)-3-acetyloxy-2-octanoyloxypropoxy]-hydroxyphosphoryl]oxy-2-aminopropanoic acid |
| SMILES | CCCCCCCC(=O)O[C@H](COC(C)=O)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H30NO10P/c1-3-4-5-6-7-8-15(19)27-13(9-24-12(2)18)10-25-28(22,23)26-11-14(17)16(20)21/h13-14H,3-11,17H2,1-2H3,(H,20,21)(H,22,23)/t13-,14+/m1/s1 |
| InChIKey | IULMAZPMWQWWRI-KGLIPLIRSA-N |
| XLogP | 1.37 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|