C20H38NO10P — CID 172994708
(2S)-2-amino-3-[[(2R)-2,3-di(heptanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 172994708) has the molecular formula C20H38NO10P and a molecular weight of 483.50 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-2,3-di(heptanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-2,3-di(heptanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 172994708 |
| Molecular Formula | C20H38NO10P |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-2,3-di(heptanoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCC |
| InChI | InChI=1S/C20H38NO10P/c1-3-5-7-9-11-18(22)28-13-16(31-19(23)12-10-8-6-4-2)14-29-32(26,27)30-15-17(21)20(24)25/h16-17H,3-15,21H2,1-2H3,(H,24,25)(H,26,27)/t16-,17+/m1/s1 |
| InChIKey | DEYVZBHHZQDSMS-SJORKVTESA-N |
| XLogP | 2.93 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|