C25H48NO10P — CID 138147501
2-amino-3-[(2-decanoyloxy-3-nonanoyloxypropoxy)-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 138147501) has the molecular formula C25H48NO10P and a molecular weight of 553.63 g/mol. Its IUPAC name is 2-amino-3-[(2-decanoyloxy-3-nonanoyloxypropoxy)-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[(2-decanoyloxy-3-nonanoyloxypropoxy)-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138147501 |
| Molecular Formula | C25H48NO10P |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | 2-amino-3-[(2-decanoyloxy-3-nonanoyloxypropoxy)-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C25H48NO10P/c1-3-5-7-9-11-13-15-17-24(28)36-21(18-33-23(27)16-14-12-10-8-6-4-2)19-34-37(31,32)35-20-22(26)25(29)30/h21-22H,3-20,26H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | DUEUYHLJWIJNPC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|