C5H14N2O5S — CID 71539035
(2R)-2-amino-3-(carboxymethylsulfanyl)propanoic acid;azane;hydrate (PubChem CID 71539035) has the molecular formula C5H14N2O5S and a molecular weight of 214.24 g/mol. Its IUPAC name is (2R)-2-amino-3-(carboxymethylsulfanyl)propanoic acid;azane;hydrate.
| Compound Name | (2R)-2-amino-3-(carboxymethylsulfanyl)propanoic acid;azane;hydrate |
|---|---|
| PubChem CID | 71539035 |
| Molecular Formula | C5H14N2O5S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2R)-2-amino-3-(carboxymethylsulfanyl)propanoic acid;azane;hydrate |
| SMILES | N.N[C@@H](CSCC(=O)O)C(=O)O.O |
| InChI | InChI=1S/C5H9NO4S.H3N.H2O/c6-3(5(9)10)1-11-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);1H3;1H2/t3-;;/m0../s1 |
| InChIKey | FNIBULIZWZBPKC-QTNFYWBSSA-N |
| XLogP | -1.45 |
| TPSA | 167.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |