C5H8N2O2S — CID 38989108
(2S)-2-amino-3-(cyanomethylsulfanyl)propanoic acid (PubChem CID 38989108) has the molecular formula C5H8N2O2S and a molecular weight of 160.20 g/mol. Its IUPAC name is (2S)-2-amino-3-(cyanomethylsulfanyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(cyanomethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 38989108 |
| Molecular Formula | C5H8N2O2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | (2S)-2-amino-3-(cyanomethylsulfanyl)propanoic acid |
| SMILES | N#CCSC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C5H8N2O2S/c6-1-2-10-3-4(7)5(8)9/h4H,2-3,7H2,(H,8,9)/t4-/m1/s1 |
| InChIKey | NNDFTEWZSBSSRF-SCSAIBSYSA-N |
| XLogP | -0.34 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|