C7H12O5S2 — CID 71360068
2-[3-(carboxymethylsulfanyl)-2-hydroxypropyl]sulfanylacetic acid (PubChem CID 71360068) has the molecular formula C7H12O5S2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[3-(carboxymethylsulfanyl)-2-hydroxypropyl]sulfanylacetic acid.
| Compound Name | 2-[3-(carboxymethylsulfanyl)-2-hydroxypropyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 71360068 |
| Molecular Formula | C7H12O5S2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-[3-(carboxymethylsulfanyl)-2-hydroxypropyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(O)CSCC(=O)O |
| InChI | InChI=1S/C7H12O5S2/c8-5(1-13-3-6(9)10)2-14-4-7(11)12/h5,8H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | GCWCKFFNVMYXNH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |