C6H10O4S — CID 88779681
(2S)-3-(carboxymethylsulfanyl)-2-methylpropanoic acid (PubChem CID 88779681) has the molecular formula C6H10O4S and a molecular weight of 178.21 g/mol. Its IUPAC name is (2S)-3-(carboxymethylsulfanyl)-2-methylpropanoic acid.
| Compound Name | (2S)-3-(carboxymethylsulfanyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 88779681 |
| Molecular Formula | C6H10O4S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | (2S)-3-(carboxymethylsulfanyl)-2-methylpropanoic acid |
| SMILES | C[C@H](CSCC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H10O4S/c1-4(6(9)10)2-11-3-5(7)8/h4H,2-3H2,1H3,(H,7,8)(H,9,10)/t4-/m1/s1 |
| InChIKey | CEUSXEBEKZCYSJ-SCSAIBSYSA-N |
| XLogP | 0.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |