C11H22O4S — CID 81223425
2-(3,3-diethoxypropylsulfanyl)-2-methylpropanoic acid (PubChem CID 81223425) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylsulfanyl)-2-methylpropanoic acid.
| Compound Name | 2-(3,3-diethoxypropylsulfanyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 81223425 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-(3,3-diethoxypropylsulfanyl)-2-methylpropanoic acid |
| SMILES | CCOC(CCSC(C)(C)C(=O)O)OCC |
| InChI | InChI=1S/C11H22O4S/c1-5-14-9(15-6-2)7-8-16-11(3,4)10(12)13/h9H,5-8H2,1-4H3,(H,12,13) |
| InChIKey | BPDWXEUCQOYIIZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|