C22H38N2O9S4 — CID 170446362
2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-oxo-7-(1-propan-2-yloxyethoxy)heptyl]disulfanyl]propanoic acid (PubChem CID 170446362) has the molecular formula C22H38N2O9S4 and a molecular weight of 602.82 g/mol. Its IUPAC name is 2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-oxo-7-(1-propan-2-yloxyethoxy)heptyl]disulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-oxo-7-(1-propan-2-yloxyethoxy)heptyl]disulfanyl]propanoic acid |
|---|---|
| PubChem CID | 170446362 |
| Molecular Formula | C22H38N2O9S4 |
| Molecular Weight | 602.82 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | 2-acetamido-3-[[2-[(2-acetamido-2-carboxyethyl)disulfanyl]-7-oxo-7-(1-propan-2-yloxyethoxy)heptyl]disulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSSCC(CCCCC(=O)OC(C)OC(C)C)SSCC(NC(C)=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H38N2O9S4/c1-13(2)32-16(5)33-20(27)9-7-6-8-17(37-36-12-19(22(30)31)24-15(4)26)10-34-35-11-18(21(28)29)23-14(3)25/h13,16-19H,6-12H2,1-5H3,(H,23,25)(H,24,26)(H,28,29)(H,30,31) |
| InChIKey | KYSWOSRFEHGNOX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 168.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|