C11H11F5N2O6S2 — CID 162577360
(2R)-3-[[2-carboxy-2-(2,2,2-trifluoroacetyl)iminoethyl]disulfanyl]-2-(2,2-difluoropropanoylamino)propanoic acid (PubChem CID 162577360) has the molecular formula C11H11F5N2O6S2 and a molecular weight of 426.34 g/mol. Its IUPAC name is (2R)-3-[[2-carboxy-2-(2,2,2-trifluoroacetyl)iminoethyl]disulfanyl]-2-(2,2-difluoropropanoylamino)propanoic acid.
| Compound Name | (2R)-3-[[2-carboxy-2-(2,2,2-trifluoroacetyl)iminoethyl]disulfanyl]-2-(2,2-difluoropropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 162577360 |
| Molecular Formula | C11H11F5N2O6S2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | (2R)-3-[[2-carboxy-2-(2,2,2-trifluoroacetyl)iminoethyl]disulfanyl]-2-(2,2-difluoropropanoylamino)propanoic acid |
| SMILES | CC(F)(F)C(=O)N[C@@H](CSSC/C(=N/C(=O)C(F)(F)F)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H11F5N2O6S2/c1-10(12,13)8(23)17-4(6(19)20)2-25-26-3-5(7(21)22)18-9(24)11(14,15)16/h4H,2-3H2,1H3,(H,17,23)(H,19,20)(H,21,22)/b18-5-/t4-/m0/s1 |
| InChIKey | FJYGVWTVFFTRMP-YIRZJFFLSA-N |
| XLogP | 1.21 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|