C7H11NO5S2 — CID 70685849
(2R)-3-(ethyldisulfanyl)-2-(oxaloamino)propanoic acid (PubChem CID 70685849) has the molecular formula C7H11NO5S2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2R)-3-(ethyldisulfanyl)-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-(ethyldisulfanyl)-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 70685849 |
| Molecular Formula | C7H11NO5S2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | (2R)-3-(ethyldisulfanyl)-2-(oxaloamino)propanoic acid |
| SMILES | CCSSC[C@H](NC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H11NO5S2/c1-2-14-15-3-4(6(10)11)8-5(9)7(12)13/h4H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t4-/m0/s1 |
| InChIKey | GGWWWKKGRALCJZ-BYPYZUCNSA-N |
| XLogP | 0.04 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|