C11H11NO6S2 — CID 70689997
(2R)-3-[(4-hydroxyphenyl)disulfanyl]-2-(oxaloamino)propanoic acid (PubChem CID 70689997) has the molecular formula C11H11NO6S2 and a molecular weight of 317.34 g/mol. Its IUPAC name is (2R)-3-[(4-hydroxyphenyl)disulfanyl]-2-(oxaloamino)propanoic acid.
| Compound Name | (2R)-3-[(4-hydroxyphenyl)disulfanyl]-2-(oxaloamino)propanoic acid |
|---|---|
| PubChem CID | 70689997 |
| Molecular Formula | C11H11NO6S2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | (2R)-3-[(4-hydroxyphenyl)disulfanyl]-2-(oxaloamino)propanoic acid |
| SMILES | O=C(O)C(=O)N[C@@H](CSSc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C11H11NO6S2/c13-6-1-3-7(4-2-6)20-19-5-8(10(15)16)12-9(14)11(17)18/h1-4,8,13H,5H2,(H,12,14)(H,15,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | IHVYJXGZLDLQPH-QMMMGPOBSA-N |
| XLogP | 0.79 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|