C14H24N2O10S6 — CID 88656826
(2R)-3-[[2-carboxy-2-[(2-methyl-2-sulfopropanethioyl)amino]ethyl]disulfanyl]-2-[(2-methyl-2-sulfopropanethioyl)amino]propanoic acid (PubChem CID 88656826) has the molecular formula C14H24N2O10S6 and a molecular weight of 572.75 g/mol. Its IUPAC name is (2R)-3-[[2-carboxy-2-[(2-methyl-2-sulfopropanethioyl)amino]ethyl]disulfanyl]-2-[(2-methyl-2-sulfopropanethioyl)amino]propanoic acid.
| Compound Name | (2R)-3-[[2-carboxy-2-[(2-methyl-2-sulfopropanethioyl)amino]ethyl]disulfanyl]-2-[(2-methyl-2-sulfopropanethioyl)amino]propanoic acid |
|---|---|
| PubChem CID | 88656826 |
| Molecular Formula | C14H24N2O10S6 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 571.98 |
| IUPAC Name | (2R)-3-[[2-carboxy-2-[(2-methyl-2-sulfopropanethioyl)amino]ethyl]disulfanyl]-2-[(2-methyl-2-sulfopropanethioyl)amino]propanoic acid |
| SMILES | CC(C)(C(=S)NC(CSSC[C@H](NC(=S)C(C)(C)S(=O)(=O)O)C(=O)O)C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C14H24N2O10S6/c1-13(2,31(21,22)23)11(27)15-7(9(17)18)5-29-30-6-8(10(19)20)16-12(28)14(3,4)32(24,25)26/h7-8H,5-6H2,1-4H3,(H,15,27)(H,16,28)(H,17,18)(H,19,20)(H,21,22,23)(H,24,25,26)/t7-,8?/m0/s1 |
| InChIKey | IOAIIUJSIMFDLO-JAMMHHFISA-N |
| XLogP | 0.44 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|