C22H42N4O6S2 — CID 59111182
(2S)-6-amino-2-[[(2S)-4-[[(3S)-4-[[(1S)-5-amino-1-carboxypentyl]amino]-3-methyl-4-oxobutyl]disulfanyl]-2-methylbutanoyl]amino]hexanoic acid (PubChem CID 59111182) has the molecular formula C22H42N4O6S2 and a molecular weight of 522.73 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-4-[[(3S)-4-[[(1S)-5-amino-1-carboxypentyl]amino]-3-methyl-4-oxobutyl]disulfanyl]-2-methylbutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-4-[[(3S)-4-[[(1S)-5-amino-1-carboxypentyl]amino]-3-methyl-4-oxobutyl]disulfanyl]-2-methylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 59111182 |
| Molecular Formula | C22H42N4O6S2 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-4-[[(3S)-4-[[(1S)-5-amino-1-carboxypentyl]amino]-3-methyl-4-oxobutyl]disulfanyl]-2-methylbutanoyl]amino]hexanoic acid |
| SMILES | C[C@@H](CCSSCC[C@H](C)C(=O)N[C@@H](CCCCN)C(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C22H42N4O6S2/c1-15(19(27)25-17(21(29)30)7-3-5-11-23)9-13-33-34-14-10-16(2)20(28)26-18(22(31)32)8-4-6-12-24/h15-18H,3-14,23-24H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)(H,31,32)/t15-,16-,17-,18-/m0/s1 |
| InChIKey | JKOFHKWVLJEBDK-XSLAGTTESA-N |
| XLogP | 1.82 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|