C5H8F3NO2S — CID 54534650
(2S)-4-sulfanyl-2-(trifluoromethylamino)butanoic acid (PubChem CID 54534650) has the molecular formula C5H8F3NO2S and a molecular weight of 203.18 g/mol. Its IUPAC name is (2S)-4-sulfanyl-2-(trifluoromethylamino)butanoic acid.
| Compound Name | (2S)-4-sulfanyl-2-(trifluoromethylamino)butanoic acid |
|---|---|
| PubChem CID | 54534650 |
| Molecular Formula | C5H8F3NO2S |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | (2S)-4-sulfanyl-2-(trifluoromethylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCS)NC(F)(F)F |
| InChI | InChI=1S/C5H8F3NO2S/c6-5(7,8)9-3(1-2-12)4(10)11/h3,9,12H,1-2H2,(H,10,11)/t3-/m0/s1 |
| InChIKey | YYXXULJLYJMRBD-VKHMYHEASA-N |
| XLogP | 0.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|