C8H17N3O3S — CID 10130890
2-[2-[(2-aminoacetyl)amino]ethylamino]-4-sulfanylbutanoic acid (PubChem CID 10130890) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[2-[(2-aminoacetyl)amino]ethylamino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[2-[(2-aminoacetyl)amino]ethylamino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 10130890 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[2-[(2-aminoacetyl)amino]ethylamino]-4-sulfanylbutanoic acid |
| SMILES | NCC(=O)NCCNC(CCS)C(=O)O |
| InChI | InChI=1S/C8H17N3O3S/c9-5-7(12)11-3-2-10-6(1-4-15)8(13)14/h6,10,15H,1-5,9H2,(H,11,12)(H,13,14) |
| InChIKey | LAXAEZAAIJANQX-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|