C8H17N3O2S — CID 54124456
(2R)-2-[2-(1-aminoethylideneamino)ethylamino]-4-sulfanylbutanoic acid (PubChem CID 54124456) has the molecular formula C8H17N3O2S and a molecular weight of 219.31 g/mol. Its IUPAC name is (2R)-2-[2-(1-aminoethylideneamino)ethylamino]-4-sulfanylbutanoic acid.
| Compound Name | (2R)-2-[2-(1-aminoethylideneamino)ethylamino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 54124456 |
| Molecular Formula | C8H17N3O2S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (2R)-2-[2-(1-aminoethylideneamino)ethylamino]-4-sulfanylbutanoic acid |
| SMILES | C/C(N)=N\CCN[C@H](CCS)C(=O)O |
| InChI | InChI=1S/C8H17N3O2S/c1-6(9)10-3-4-11-7(2-5-14)8(12)13/h7,11,14H,2-5H2,1H3,(H2,9,10)(H,12,13)/t7-/m1/s1 |
| InChIKey | NPZDGGBAGCYCFG-SSDOTTSWSA-N |
| XLogP | -0.27 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|