C7H13F2N3O2S — CID 57177921
(2R)-2-[[2-(1-aminoethylideneamino)-1,1-difluoroethyl]amino]-3-sulfanylpropanoic acid (PubChem CID 57177921) has the molecular formula C7H13F2N3O2S and a molecular weight of 241.26 g/mol. Its IUPAC name is (2R)-2-[[2-(1-aminoethylideneamino)-1,1-difluoroethyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[2-(1-aminoethylideneamino)-1,1-difluoroethyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57177921 |
| Molecular Formula | C7H13F2N3O2S |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (2R)-2-[[2-(1-aminoethylideneamino)-1,1-difluoroethyl]amino]-3-sulfanylpropanoic acid |
| SMILES | C/C(N)=N\CC(F)(F)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C7H13F2N3O2S/c1-4(10)11-3-7(8,9)12-5(2-15)6(13)14/h5,12,15H,2-3H2,1H3,(H2,10,11)(H,13,14)/t5-/m0/s1 |
| InChIKey | JSSYIVCIDKHCJZ-YFKPBYRVSA-N |
| XLogP | -0.07 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|