C7H15N3O2S — CID 140976881
N-[2-[(2-aminoacetyl)amino]ethyl]-3-sulfanylpropanamide (PubChem CID 140976881) has the molecular formula C7H15N3O2S and a molecular weight of 205.28 g/mol. Its IUPAC name is N-[2-[(2-aminoacetyl)amino]ethyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-[(2-aminoacetyl)amino]ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 140976881 |
| Molecular Formula | C7H15N3O2S |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-[2-[(2-aminoacetyl)amino]ethyl]-3-sulfanylpropanamide |
| SMILES | NCC(=O)NCCNC(=O)CCS |
| InChI | InChI=1S/C7H15N3O2S/c8-5-7(12)10-3-2-9-6(11)1-4-13/h13H,1-5,8H2,(H,9,11)(H,10,12) |
| InChIKey | LOINSCOBWGIGPD-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|