C7H16N4O2 — CID 118189326
2-amino-N-[2-[(3-amino-2-oxopropyl)amino]ethyl]acetamide (PubChem CID 118189326) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-amino-N-[2-[(3-amino-2-oxopropyl)amino]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-[(3-amino-2-oxopropyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 118189326 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-amino-N-[2-[(3-amino-2-oxopropyl)amino]ethyl]acetamide |
| SMILES | NCC(=O)CNCCNC(=O)CN |
| InChI | InChI=1S/C7H16N4O2/c8-3-6(12)5-10-1-2-11-7(13)4-9/h10H,1-5,8-9H2,(H,11,13) |
| InChIKey | XGAWPJIIZPQHSF-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|