C12H27N7O3 — CID 59349236
2-amino-N-[2-[bis[2-[(2-aminoacetyl)amino]ethyl]amino]ethyl]acetamide (PubChem CID 59349236) has the molecular formula C12H27N7O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-amino-N-[2-[bis[2-[(2-aminoacetyl)amino]ethyl]amino]ethyl]acetamide.
| Compound Name | 2-amino-N-[2-[bis[2-[(2-aminoacetyl)amino]ethyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 59349236 |
| Molecular Formula | C12H27N7O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 2-amino-N-[2-[bis[2-[(2-aminoacetyl)amino]ethyl]amino]ethyl]acetamide |
| SMILES | NCC(=O)NCCN(CCNC(=O)CN)CCNC(=O)CN |
| InChI | InChI=1S/C12H27N7O3/c13-7-10(20)16-1-4-19(5-2-17-11(21)8-14)6-3-18-12(22)9-15/h1-9,13-15H2,(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | XKMIDTDPUXMBMF-UHFFFAOYSA-N |
| XLogP | -4.49 |
| TPSA | 168.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |